C10HF13O — CID 89285940
1,2,3,4,5-pentafluoro-6-[1,1,3,3,3-pentafluoro-2-(trifluoromethyl)propoxy]benzene (PubChem CID 89285940) has the molecular formula C10HF13O and a molecular weight of 384.09 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[1,1,3,3,3-pentafluoro-2-(trifluoromethyl)propoxy]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[1,1,3,3,3-pentafluoro-2-(trifluoromethyl)propoxy]benzene |
|---|---|
| PubChem CID | 89285940 |
| Molecular Formula | C10HF13O |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 383.98 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[1,1,3,3,3-pentafluoro-2-(trifluoromethyl)propoxy]benzene |
| SMILES | Fc1c(F)c(F)c(OC(F)(F)C(C(F)(F)F)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C10HF13O/c11-1-2(12)4(14)6(5(15)3(1)13)24-10(22,23)7(8(16,17)18)9(19,20)21/h7H |
| InChIKey | SNLDPKBZPZJPAP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|