C14H18F4O2 — CID 22625262
1,2,3,4-tetrafluoro-5,6-bis[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 22625262) has the molecular formula C14H18F4O2 and a molecular weight of 294.29 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5,6-bis[(2-methylpropan-2-yl)oxy]benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5,6-bis[(2-methylpropan-2-yl)oxy]benzene |
|---|---|
| PubChem CID | 22625262 |
| Molecular Formula | C14H18F4O2 |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5,6-bis[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | CC(C)(C)Oc1c(F)c(F)c(F)c(F)c1OC(C)(C)C |
| InChI | InChI=1S/C14H18F4O2/c1-13(2,3)19-11-9(17)7(15)8(16)10(18)12(11)20-14(4,5)6/h1-6H3 |
| InChIKey | QIVTYBYAOIZVJM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|