C10H9F5O — CID 14775650
1-butoxy-2,3,4,5,6-pentafluorobenzene (PubChem CID 14775650) has the molecular formula C10H9F5O and a molecular weight of 240.17 g/mol. Its IUPAC name is 1-butoxy-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-butoxy-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 14775650 |
| Molecular Formula | C10H9F5O |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-butoxy-2,3,4,5,6-pentafluorobenzene |
| SMILES | CCCCOc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H9F5O/c1-2-3-4-16-10-8(14)6(12)5(11)7(13)9(10)15/h2-4H2,1H3 |
| InChIKey | SEWOSXBRSXXVHE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|