C8H2F9NO — CID 175991056
1,2,2,2-tetrafluoro-1-(2,3,4,5,6-pentafluorophenoxy)ethanamine (PubChem CID 175991056) has the molecular formula C8H2F9NO and a molecular weight of 299.09 g/mol. Its IUPAC name is 1,2,2,2-tetrafluoro-1-(2,3,4,5,6-pentafluorophenoxy)ethanamine.
| Compound Name | 1,2,2,2-tetrafluoro-1-(2,3,4,5,6-pentafluorophenoxy)ethanamine |
|---|---|
| PubChem CID | 175991056 |
| Molecular Formula | C8H2F9NO |
| Molecular Weight | 299.09 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 1,2,2,2-tetrafluoro-1-(2,3,4,5,6-pentafluorophenoxy)ethanamine |
| SMILES | NC(F)(Oc1c(F)c(F)c(F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C8H2F9NO/c9-1-2(10)4(12)6(5(13)3(1)11)19-8(17,18)7(14,15)16/h18H2 |
| InChIKey | CTIBDGPNRQNNTM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|