C14H3F11O2 — CID 177164134
1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-(trifluoromethoxy)phenyl]benzene (PubChem CID 177164134) has the molecular formula C14H3F11O2 and a molecular weight of 412.15 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-(trifluoromethoxy)phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-(trifluoromethoxy)phenyl]benzene |
|---|---|
| PubChem CID | 177164134 |
| Molecular Formula | C14H3F11O2 |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methoxy-6-[2,3,5,6-tetrafluoro-4-(trifluoromethoxy)phenyl]benzene |
| SMILES | COc1c(F)c(F)c(-c2c(F)c(F)c(OC(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H3F11O2/c1-26-12-8(19)4(15)2(5(16)9(12)20)3-6(17)10(21)13(11(22)7(3)18)27-14(23,24)25/h1H3 |
| InChIKey | ILQYTYUZDJHVCV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|