C14H7F7O3S — CID 173335169
1,2,4,5-tetrafluoro-3-methoxy-6-[2-(trifluoromethylsulfonyl)phenyl]benzene (PubChem CID 173335169) has the molecular formula C14H7F7O3S and a molecular weight of 388.26 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-methoxy-6-[2-(trifluoromethylsulfonyl)phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-methoxy-6-[2-(trifluoromethylsulfonyl)phenyl]benzene |
|---|---|
| PubChem CID | 173335169 |
| Molecular Formula | C14H7F7O3S |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-methoxy-6-[2-(trifluoromethylsulfonyl)phenyl]benzene |
| SMILES | COc1c(F)c(F)c(-c2ccccc2S(=O)(=O)C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C14H7F7O3S/c1-24-13-11(17)9(15)8(10(16)12(13)18)6-4-2-3-5-7(6)25(22,23)14(19,20)21/h2-5H,1H3 |
| InChIKey | IWQAUDKXXWAXAZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|