C21H13F7O3S — CID 22907525
6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene (PubChem CID 22907525) has the molecular formula C21H13F7O3S and a molecular weight of 478.39 g/mol. Its IUPAC name is 6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene.
| Compound Name | 6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene |
|---|---|
| PubChem CID | 22907525 |
| Molecular Formula | C21H13F7O3S |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 6-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-5-[4-(trifluoromethylsulfonyl)phenyl]spiro[2.4]hepta-4,6-diene |
| SMILES | COc1c(F)c(F)c(C2=CC3(C=C2c2ccc(S(=O)(=O)C(F)(F)F)cc2)CC3)c(F)c1F |
| InChI | InChI=1S/C21H13F7O3S/c1-31-19-17(24)15(22)14(16(23)18(19)25)13-9-20(6-7-20)8-12(13)10-2-4-11(5-3-10)32(29,30)21(26,27)28/h2-5,8-9H,6-7H2,1H3 |
| InChIKey | AKQLYQLAKPADKO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|