C28H6F16O — CID 87428315
1,2,3,4,6-pentafluoro-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene (PubChem CID 87428315) has the molecular formula C28H6F16O and a molecular weight of 662.32 g/mol. Its IUPAC name is 1,2,3,4,6-pentafluoro-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene.
| Compound Name | 1,2,3,4,6-pentafluoro-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene |
|---|---|
| PubChem CID | 87428315 |
| Molecular Formula | C28H6F16O |
| Molecular Weight | 662.32 g/mol |
| Exact Mass | 662.02 |
| IUPAC Name | 1,2,3,4,6-pentafluoro-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)-9-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]anthracene |
| SMILES | COc1c(F)c(F)c(-c2c3cc(F)ccc3c(-c3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C28H6F16O/c1-45-27-25(40)19(34)13(20(35)26(27)41)9-7-4-5(29)2-3-6(7)8(10-11(9)16(31)24(39)23(38)15(10)30)12-17(32)21(36)14(28(42,43)44)22(37)18(12)33/h2-4H,1H3 |
| InChIKey | CSNSIYHJNIJVRT-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.32 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|