C24H5F15O — CID 177164200
1,2,3,4,6,7-hexafluoro-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-(2,3,5,6-tetrafluoro-4-methoxyphenyl)naphthalene (PubChem CID 177164200) has the molecular formula C24H5F15O and a molecular weight of 594.27 g/mol. Its IUPAC name is 1,2,3,4,6,7-hexafluoro-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-(2,3,5,6-tetrafluoro-4-methoxyphenyl)naphthalene.
| Compound Name | 1,2,3,4,6,7-hexafluoro-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-(2,3,5,6-tetrafluoro-4-methoxyphenyl)naphthalene |
|---|---|
| PubChem CID | 177164200 |
| Molecular Formula | C24H5F15O |
| Molecular Weight | 594.27 g/mol |
| Exact Mass | 594.01 |
| IUPAC Name | 1,2,3,4,6,7-hexafluoro-5-[(2,3,4,5,6-pentafluorophenyl)methyl]-8-(2,3,5,6-tetrafluoro-4-methoxyphenyl)naphthalene |
| SMILES | COc1c(F)c(F)c(-c2c(F)c(F)c(Cc3c(F)c(F)c(F)c(F)c3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C24H5F15O/c1-40-24-22(38)15(31)8(16(32)23(24)39)7-6-5(12(28)19(35)20(36)14(6)30)3(9(25)13(7)29)2-4-10(26)17(33)21(37)18(34)11(4)27/h2H2,1H3 |
| InChIKey | FMBIUMJSPSDJRX-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.27 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|