C16H10F4O3 — CID 54409567
2-oxo-2-[4-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]phenyl]acetaldehyde (PubChem CID 54409567) has the molecular formula C16H10F4O3 and a molecular weight of 326.25 g/mol. Its IUPAC name is 2-oxo-2-[4-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]phenyl]acetaldehyde.
| Compound Name | 2-oxo-2-[4-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]phenyl]acetaldehyde |
|---|---|
| PubChem CID | 54409567 |
| Molecular Formula | C16H10F4O3 |
| Molecular Weight | 326.25 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 2-oxo-2-[4-[(2,3,5,6-tetrafluoro-4-methoxyphenyl)methyl]phenyl]acetaldehyde |
| SMILES | COc1c(F)c(F)c(Cc2ccc(C(=O)C=O)cc2)c(F)c1F |
| InChI | InChI=1S/C16H10F4O3/c1-23-16-14(19)12(17)10(13(18)15(16)20)6-8-2-4-9(5-3-8)11(22)7-21/h2-5,7H,6H2,1H3 |
| InChIKey | VTDHJCWQVHRKLM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|