C10H9F3O2 — CID 117117805
3-(2,4,5-trifluoro-3-methoxyphenyl)propanal (PubChem CID 117117805) has the molecular formula C10H9F3O2 and a molecular weight of 218.17 g/mol. Its IUPAC name is 3-(2,4,5-trifluoro-3-methoxyphenyl)propanal.
| Compound Name | 3-(2,4,5-trifluoro-3-methoxyphenyl)propanal |
|---|---|
| PubChem CID | 117117805 |
| Molecular Formula | C10H9F3O2 |
| Molecular Weight | 218.17 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 3-(2,4,5-trifluoro-3-methoxyphenyl)propanal |
| SMILES | COc1c(F)c(F)cc(CCC=O)c1F |
| InChI | InChI=1S/C10H9F3O2/c1-15-10-8(12)6(3-2-4-14)5-7(11)9(10)13/h4-5H,2-3H2,1H3 |
| InChIKey | WLELXVRSLANGQN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.17 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|