C10H10F3NO — CID 174978085
3-[3-(aminomethyl)-2,4,5-trifluorophenyl]propanal (PubChem CID 174978085) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 3-[3-(aminomethyl)-2,4,5-trifluorophenyl]propanal.
| Compound Name | 3-[3-(aminomethyl)-2,4,5-trifluorophenyl]propanal |
|---|---|
| PubChem CID | 174978085 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-[3-(aminomethyl)-2,4,5-trifluorophenyl]propanal |
| SMILES | NCc1c(F)c(F)cc(CCC=O)c1F |
| InChI | InChI=1S/C10H10F3NO/c11-8-4-6(2-1-3-15)9(12)7(5-14)10(8)13/h3-4H,1-2,5,14H2 |
| InChIKey | ZEHGJQNSYVJGPA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|