C8H7F2NO — CID 117276821
2-(aminomethyl)-4,5-difluorobenzaldehyde (PubChem CID 117276821) has the molecular formula C8H7F2NO and a molecular weight of 171.15 g/mol. Its IUPAC name is 2-(aminomethyl)-4,5-difluorobenzaldehyde.
| Compound Name | 2-(aminomethyl)-4,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 117276821 |
| Molecular Formula | C8H7F2NO |
| Molecular Weight | 171.15 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 2-(aminomethyl)-4,5-difluorobenzaldehyde |
| SMILES | NCc1cc(F)c(F)cc1C=O |
| InChI | InChI=1S/C8H7F2NO/c9-7-1-5(3-11)6(4-12)2-8(7)10/h1-2,4H,3,11H2 |
| InChIKey | KQMNBELFCVPVLJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|