C10H12F3NO — CID 143152028
N,N-dimethylmethanamine;2,4,5-trifluorobenzaldehyde (PubChem CID 143152028) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is N,N-dimethylmethanamine;2,4,5-trifluorobenzaldehyde.
| Compound Name | N,N-dimethylmethanamine;2,4,5-trifluorobenzaldehyde |
|---|---|
| PubChem CID | 143152028 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | N,N-dimethylmethanamine;2,4,5-trifluorobenzaldehyde |
| SMILES | CN(C)C.O=Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C7H3F3O.C3H9N/c8-5-2-7(10)6(9)1-4(5)3-11;1-4(2)3/h1-3H;1-3H3 |
| InChIKey | UYWQIBRJXKYNJC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|