About CID 123988407
CID 123988407 (PubChem CID 123988407) has the molecular formula C9H9BFO
and a molecular weight of 162.98 g/mol.
Molecular Properties
| Compound Name | CID 123988407 |
| PubChem CID | 123988407 |
| Molecular Formula | C9H9BFO |
| Molecular Weight | 162.98 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | — |
| SMILES | C[B]c1cc(C=O)c(F)cc1C |
| InChI | InChI=1S/C9H9BFO/c1-6-3-9(11)7(5-12)4-8(6)10-2/h3-5H,1-2H3 |
| InChIKey | WMGIHYGUZOEDRX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.98 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123988407 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123988407?
The IUPAC name of CID 123988407 (CID 123988407) is not available.
What is the SMILES notation for CID 123988407?
The canonical SMILES for CID 123988407 is C[B]c1cc(C=O)c(F)cc1C.
What is the InChIKey of CID 123988407?
The InChIKey is WMGIHYGUZOEDRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BFO/c1-6-3-9(11)7(5-12)4-8(6)10-2/h3-5H,1-2H3.
What are the key properties of CID 123988407?
CID 123988407 has a molecular weight of 162.98 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123988407 is sourced from PubChem (CID 123988407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).