C18H19FO — CID 63424637
2-fluoro-4-(2,3,4,5,6-pentamethylphenyl)benzaldehyde (PubChem CID 63424637) has the molecular formula C18H19FO and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-fluoro-4-(2,3,4,5,6-pentamethylphenyl)benzaldehyde.
| Compound Name | 2-fluoro-4-(2,3,4,5,6-pentamethylphenyl)benzaldehyde |
|---|---|
| PubChem CID | 63424637 |
| Molecular Formula | C18H19FO |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-fluoro-4-(2,3,4,5,6-pentamethylphenyl)benzaldehyde |
| SMILES | Cc1c(C)c(C)c(-c2ccc(C=O)c(F)c2)c(C)c1C |
| InChI | InChI=1S/C18H19FO/c1-10-11(2)13(4)18(14(5)12(10)3)15-6-7-16(9-20)17(19)8-15/h6-9H,1-5H3 |
| InChIKey | VMQQBJLAXIUCBZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|