C19H21FO — CID 63424861
4-[2,4-di(propan-2-yl)phenyl]-2-fluorobenzaldehyde (PubChem CID 63424861) has the molecular formula C19H21FO and a molecular weight of 284.37 g/mol. Its IUPAC name is 4-[2,4-di(propan-2-yl)phenyl]-2-fluorobenzaldehyde.
| Compound Name | 4-[2,4-di(propan-2-yl)phenyl]-2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 63424861 |
| Molecular Formula | C19H21FO |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 4-[2,4-di(propan-2-yl)phenyl]-2-fluorobenzaldehyde |
| SMILES | CC(C)c1ccc(-c2ccc(C=O)c(F)c2)c(C(C)C)c1 |
| InChI | InChI=1S/C19H21FO/c1-12(2)14-7-8-17(18(9-14)13(3)4)15-5-6-16(11-21)19(20)10-15/h5-13H,1-4H3 |
| InChIKey | LOWFFUWVJQALEH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|