About 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene
1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene (PubChem CID 173271154) has the molecular formula C24H26O
and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene |
| PubChem CID | 173271154 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(-c2ccc(Oc3ccccc3)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C24H26O/c1-17(2)20-12-15-23(24(16-20)18(3)4)19-10-13-22(14-11-19)25-21-8-6-5-7-9-21/h5-18H,1-4H3 |
| InChIKey | RXZMTOGJGBTBNA-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene?
The IUPAC name of 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene (CID 173271154) is 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene.
What is the SMILES notation for 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene?
The canonical SMILES for 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene is CC(C)c1ccc(-c2ccc(Oc3ccccc3)cc2)c(C(C)C)c1.
What is the InChIKey of 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene?
The InChIKey is RXZMTOGJGBTBNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O/c1-17(2)20-12-15-23(24(16-20)18(3)4)19-10-13-22(14-11-19)25-21-8-6-5-7-9-21/h5-18H,1-4H3.
What are the key properties of 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene?
1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene has a molecular weight of 330.47 g/mol, XLogP of 7.39, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-phenoxyphenyl)-2,4-di(propan-2-yl)benzene is sourced from PubChem (CID 173271154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).