C30H31N — CID 173271590
4-[2,4-di(propan-2-yl)phenyl]-N,N-diphenylaniline (PubChem CID 173271590) has the molecular formula C30H31N and a molecular weight of 405.59 g/mol. Its IUPAC name is 4-[2,4-di(propan-2-yl)phenyl]-N,N-diphenylaniline.
| Compound Name | 4-[2,4-di(propan-2-yl)phenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 173271590 |
| Molecular Formula | C30H31N |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 4-[2,4-di(propan-2-yl)phenyl]-N,N-diphenylaniline |
| SMILES | CC(C)c1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C(C)C)c1 |
| InChI | InChI=1S/C30H31N/c1-22(2)25-17-20-29(30(21-25)23(3)4)24-15-18-28(19-16-24)31(26-11-7-5-8-12-26)27-13-9-6-10-14-27/h5-23H,1-4H3 |
| InChIKey | XYBVGAFHTLVKOM-UHFFFAOYSA-N |
| XLogP | 9.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 9.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |