About CID 91869714
CID 91869714 (PubChem CID 91869714) has the molecular formula C15H15BO
and a molecular weight of 222.10 g/mol.
Molecular Properties
| Compound Name | CID 91869714 |
| PubChem CID | 91869714 |
| Molecular Formula | C15H15BO |
| Molecular Weight | 222.10 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Oc2cccc(C(C)C)c2)cc1 |
| InChI | InChI=1S/C15H15BO/c1-11(2)12-4-3-5-15(10-12)17-14-8-6-13(16)7-9-14/h3-11H,1-2H3 |
| InChIKey | JRHGEHLIIAFQLF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.10 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 91869714 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91869714?
The IUPAC name of CID 91869714 (CID 91869714) is not available.
What is the SMILES notation for CID 91869714?
The canonical SMILES for CID 91869714 is [B]c1ccc(Oc2cccc(C(C)C)c2)cc1.
What is the InChIKey of CID 91869714?
The InChIKey is JRHGEHLIIAFQLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BO/c1-11(2)12-4-3-5-15(10-12)17-14-8-6-13(16)7-9-14/h3-11H,1-2H3.
What are the key properties of CID 91869714?
CID 91869714 has a molecular weight of 222.10 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91869714 is sourced from PubChem (CID 91869714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).