C17H14N2O — CID 123578088
1,2-diisocyano-4-(3-propan-2-ylphenoxy)benzene (PubChem CID 123578088) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 1,2-diisocyano-4-(3-propan-2-ylphenoxy)benzene.
| Compound Name | 1,2-diisocyano-4-(3-propan-2-ylphenoxy)benzene |
|---|---|
| PubChem CID | 123578088 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1,2-diisocyano-4-(3-propan-2-ylphenoxy)benzene |
| SMILES | [C-]#[N+]c1ccc(Oc2cccc(C(C)C)c2)cc1[N+]#[C-] |
| InChI | InChI=1S/C17H14N2O/c1-12(2)13-6-5-7-14(10-13)20-15-8-9-16(18-3)17(11-15)19-4/h5-12H,1-2H3 |
| InChIKey | FNYZGTIDCTWJBL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 17.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|