C17H10N2O2 — CID 162699138
1,2-diisocyano-4-(3-prop-2-ynoxyphenoxy)benzene (PubChem CID 162699138) has the molecular formula C17H10N2O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is 1,2-diisocyano-4-(3-prop-2-ynoxyphenoxy)benzene.
| Compound Name | 1,2-diisocyano-4-(3-prop-2-ynoxyphenoxy)benzene |
|---|---|
| PubChem CID | 162699138 |
| Molecular Formula | C17H10N2O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1,2-diisocyano-4-(3-prop-2-ynoxyphenoxy)benzene |
| SMILES | [C-]#[N+]c1ccc(Oc2cccc(OCC#C)c2)cc1[N+]#[C-] |
| InChI | InChI=1S/C17H10N2O2/c1-4-10-20-13-6-5-7-14(11-13)21-15-8-9-16(18-2)17(12-15)19-3/h1,5-9,11-12H,10H2 |
| InChIKey | HQXZVXJIOIBCDC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|