C25H28O5 — CID 24800476
(4-phenoxyphenyl)-(2,3,4-trimethoxy-5-propan-2-ylphenyl)methanol (PubChem CID 24800476) has the molecular formula C25H28O5 and a molecular weight of 408.49 g/mol. Its IUPAC name is (4-phenoxyphenyl)-(2,3,4-trimethoxy-5-propan-2-ylphenyl)methanol.
| Compound Name | (4-phenoxyphenyl)-(2,3,4-trimethoxy-5-propan-2-ylphenyl)methanol |
|---|---|
| PubChem CID | 24800476 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | (4-phenoxyphenyl)-(2,3,4-trimethoxy-5-propan-2-ylphenyl)methanol |
| SMILES | COc1c(C(C)C)cc(C(O)c2ccc(Oc3ccccc3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C25H28O5/c1-16(2)20-15-21(24(28-4)25(29-5)23(20)27-3)22(26)17-11-13-19(14-12-17)30-18-9-7-6-8-10-18/h6-16,22,26H,1-5H3 |
| InChIKey | ABEJAQZOALWNAQ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |