C28H40O3 — CID 143595124
2,4-dimethoxy-1-methylbenzene;ethane;1-phenoxy-4-propan-2-ylbenzene (PubChem CID 143595124) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is 2,4-dimethoxy-1-methylbenzene;ethane;1-phenoxy-4-propan-2-ylbenzene.
| Compound Name | 2,4-dimethoxy-1-methylbenzene;ethane;1-phenoxy-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 143595124 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | 2,4-dimethoxy-1-methylbenzene;ethane;1-phenoxy-4-propan-2-ylbenzene |
| SMILES | CC.CC.CC(C)c1ccc(Oc2ccccc2)cc1.COc1ccc(C)c(OC)c1 |
| InChI | InChI=1S/C15H16O.C9H12O2.2C2H6/c1-12(2)13-8-10-15(11-9-13)16-14-6-4-3-5-7-14;1-7-4-5-8(10-2)6-9(7)11-3;2*1-2/h3-12H,1-2H3;4-6H,1-3H3;2*1-2H3 |
| InChIKey | OUWHYMNPTSTOOX-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |