About cumene;ethane;1-ethyl-3-methoxybenzene
cumene;ethane;1-ethyl-3-methoxybenzene (PubChem CID 171630693) has the molecular formula C20H30O
and a molecular weight of 286.46 g/mol. Its IUPAC name is cumene;ethane;1-ethyl-3-methoxybenzene.
Molecular Properties
| Compound Name | cumene;ethane;1-ethyl-3-methoxybenzene |
| PubChem CID | 171630693 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | cumene;ethane;1-ethyl-3-methoxybenzene |
| SMILES | CC.CC(C)c1ccccc1.CCc1cccc(OC)c1 |
| InChI | InChI=1S/C9H12O.C9H12.C2H6/c1-3-8-5-4-6-9(7-8)10-2;1-8(2)9-6-4-3-5-7-9;1-2/h4-7H,3H2,1-2H3;3-8H,1-2H3;1-2H3 |
| InChIKey | SGUDIEBLUGKXHS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cumene;ethane;1-ethyl-3-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ethane;1-ethyl-3-methoxybenzene?
The IUPAC name of cumene;ethane;1-ethyl-3-methoxybenzene (CID 171630693) is cumene;ethane;1-ethyl-3-methoxybenzene.
What is the SMILES notation for cumene;ethane;1-ethyl-3-methoxybenzene?
The canonical SMILES for cumene;ethane;1-ethyl-3-methoxybenzene is CC.CC(C)c1ccccc1.CCc1cccc(OC)c1.
What is the InChIKey of cumene;ethane;1-ethyl-3-methoxybenzene?
The InChIKey is SGUDIEBLUGKXHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C9H12.C2H6/c1-3-8-5-4-6-9(7-8)10-2;1-8(2)9-6-4-3-5-7-9;1-2/h4-7H,3H2,1-2H3;3-8H,1-2H3;1-2H3.
What are the key properties of cumene;ethane;1-ethyl-3-methoxybenzene?
cumene;ethane;1-ethyl-3-methoxybenzene has a molecular weight of 286.46 g/mol, XLogP of 6.09, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ethane;1-ethyl-3-methoxybenzene is sourced from PubChem (CID 171630693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).