About ethane;1-ethyl-3-methoxybenzene;propylbenzene
ethane;1-ethyl-3-methoxybenzene;propylbenzene (PubChem CID 142554792) has the molecular formula C20H30O
and a molecular weight of 286.46 g/mol. Its IUPAC name is ethane;1-ethyl-3-methoxybenzene;propylbenzene.
Molecular Properties
| Compound Name | ethane;1-ethyl-3-methoxybenzene;propylbenzene |
| PubChem CID | 142554792 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | ethane;1-ethyl-3-methoxybenzene;propylbenzene |
| SMILES | CC.CCCc1ccccc1.CCc1cccc(OC)c1 |
| InChI | InChI=1S/C9H12O.C9H12.C2H6/c1-3-8-5-4-6-9(7-8)10-2;1-2-6-9-7-4-3-5-8-9;1-2/h4-7H,3H2,1-2H3;3-5,7-8H,2,6H2,1H3;1-2H3 |
| InChIKey | XHUWWPVHXDWZGC-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-3-methoxybenzene;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-3-methoxybenzene;propylbenzene?
The IUPAC name of ethane;1-ethyl-3-methoxybenzene;propylbenzene (CID 142554792) is ethane;1-ethyl-3-methoxybenzene;propylbenzene.
What is the SMILES notation for ethane;1-ethyl-3-methoxybenzene;propylbenzene?
The canonical SMILES for ethane;1-ethyl-3-methoxybenzene;propylbenzene is CC.CCCc1ccccc1.CCc1cccc(OC)c1.
What is the InChIKey of ethane;1-ethyl-3-methoxybenzene;propylbenzene?
The InChIKey is XHUWWPVHXDWZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.C9H12.C2H6/c1-3-8-5-4-6-9(7-8)10-2;1-2-6-9-7-4-3-5-8-9;1-2/h4-7H,3H2,1-2H3;3-5,7-8H,2,6H2,1H3;1-2H3.
What are the key properties of ethane;1-ethyl-3-methoxybenzene;propylbenzene?
ethane;1-ethyl-3-methoxybenzene;propylbenzene has a molecular weight of 286.46 g/mol, XLogP of 5.92, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-3-methoxybenzene;propylbenzene is sourced from PubChem (CID 142554792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).