About 1-ethyl-3-methoxybenzene;hydrofluoride
1-ethyl-3-methoxybenzene;hydrofluoride (PubChem CID 174493623) has the molecular formula C9H13FO
and a molecular weight of 156.20 g/mol. Its IUPAC name is 1-ethyl-3-methoxybenzene;hydrofluoride.
Molecular Properties
| Compound Name | 1-ethyl-3-methoxybenzene;hydrofluoride |
| PubChem CID | 174493623 |
| Molecular Formula | C9H13FO |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.10 |
| IUPAC Name | 1-ethyl-3-methoxybenzene;hydrofluoride |
| SMILES | CCc1cccc(OC)c1.F |
| InChI | InChI=1S/C9H12O.FH/c1-3-8-5-4-6-9(7-8)10-2;/h4-7H,3H2,1-2H3;1H |
| InChIKey | ZDZRRSDARGRHND-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-3-methoxybenzene;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3-methoxybenzene;hydrofluoride?
The IUPAC name of 1-ethyl-3-methoxybenzene;hydrofluoride (CID 174493623) is 1-ethyl-3-methoxybenzene;hydrofluoride.
What is the SMILES notation for 1-ethyl-3-methoxybenzene;hydrofluoride?
The canonical SMILES for 1-ethyl-3-methoxybenzene;hydrofluoride is CCc1cccc(OC)c1.F.
What is the InChIKey of 1-ethyl-3-methoxybenzene;hydrofluoride?
The InChIKey is ZDZRRSDARGRHND-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.FH/c1-3-8-5-4-6-9(7-8)10-2;/h4-7H,3H2,1-2H3;1H.
What are the key properties of 1-ethyl-3-methoxybenzene;hydrofluoride?
1-ethyl-3-methoxybenzene;hydrofluoride has a molecular weight of 156.20 g/mol, XLogP of 2.41, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3-methoxybenzene;hydrofluoride is sourced from PubChem (CID 174493623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).