About (3-ethylphenyl) hypoiodite
(3-ethylphenyl) hypoiodite (PubChem CID 71211599) has the molecular formula C8H9IO
and a molecular weight of 248.06 g/mol. Its IUPAC name is (3-ethylphenyl) hypoiodite.
Molecular Properties
| Compound Name | (3-ethylphenyl) hypoiodite |
| PubChem CID | 71211599 |
| Molecular Formula | C8H9IO |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | (3-ethylphenyl) hypoiodite |
| SMILES | CCc1cccc(OI)c1 |
| InChI | InChI=1S/C8H9IO/c1-2-7-4-3-5-8(6-7)10-9/h3-6H,2H2,1H3 |
| InChIKey | GWVJGHULRZGDLS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylphenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylphenyl) hypoiodite?
The IUPAC name of (3-ethylphenyl) hypoiodite (CID 71211599) is (3-ethylphenyl) hypoiodite.
What is the SMILES notation for (3-ethylphenyl) hypoiodite?
The canonical SMILES for (3-ethylphenyl) hypoiodite is CCc1cccc(OI)c1.
What is the InChIKey of (3-ethylphenyl) hypoiodite?
The InChIKey is GWVJGHULRZGDLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IO/c1-2-7-4-3-5-8(6-7)10-9/h3-6H,2H2,1H3.
What are the key properties of (3-ethylphenyl) hypoiodite?
(3-ethylphenyl) hypoiodite has a molecular weight of 248.06 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylphenyl) hypoiodite is sourced from PubChem (CID 71211599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).