C15H17NO — CID 20539517
7-azabicyclo[4.1.0]hepta-1,3,5-triene;1-ethyl-3-methoxybenzene (PubChem CID 20539517) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 7-azabicyclo[4.1.0]hepta-1,3,5-triene;1-ethyl-3-methoxybenzene.
| Compound Name | 7-azabicyclo[4.1.0]hepta-1,3,5-triene;1-ethyl-3-methoxybenzene |
|---|---|
| PubChem CID | 20539517 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 7-azabicyclo[4.1.0]hepta-1,3,5-triene;1-ethyl-3-methoxybenzene |
| SMILES | CCc1cccc(OC)c1.c1ccc2c(c1)N2 |
| InChI | InChI=1S/C9H12O.C6H5N/c1-3-8-5-4-6-9(7-8)10-2;1-2-4-6-5(3-1)7-6/h4-7H,3H2,1-2H3;1-4,7H |
| InChIKey | AMROSQFBRMDXSN-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 31.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|