C21H30O — CID 178169906
1,3-di(propan-2-yl)benzene;1-ethyl-3-methoxybenzene (PubChem CID 178169906) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 1,3-di(propan-2-yl)benzene;1-ethyl-3-methoxybenzene.
| Compound Name | 1,3-di(propan-2-yl)benzene;1-ethyl-3-methoxybenzene |
|---|---|
| PubChem CID | 178169906 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 1,3-di(propan-2-yl)benzene;1-ethyl-3-methoxybenzene |
| SMILES | CC(C)c1cccc(C(C)C)c1.CCc1cccc(OC)c1 |
| InChI | InChI=1S/C12H18.C9H12O/c1-9(2)11-6-5-7-12(8-11)10(3)4;1-3-8-5-4-6-9(7-8)10-2/h5-10H,1-4H3;4-7H,3H2,1-2H3 |
| InChIKey | LUTAUYMMCJZTCQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |