About cumene;ethylbenzene;methane
cumene;ethylbenzene;methane (PubChem CID 159529846) has the molecular formula C18H26
and a molecular weight of 242.41 g/mol. Its IUPAC name is cumene;ethylbenzene;methane.
Molecular Properties
| Compound Name | cumene;ethylbenzene;methane |
| PubChem CID | 159529846 |
| Molecular Formula | C18H26 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | cumene;ethylbenzene;methane |
| SMILES | C.CC(C)c1ccccc1.CCc1ccccc1 |
| InChI | InChI=1S/C9H12.C8H10.CH4/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8;/h3-8H,1-2H3;3-7H,2H2,1H3;1H4 |
| InChIKey | MCVUYYNRLFJIAR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;ethylbenzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ethylbenzene;methane?
The IUPAC name of cumene;ethylbenzene;methane (CID 159529846) is cumene;ethylbenzene;methane.
What is the SMILES notation for cumene;ethylbenzene;methane?
The canonical SMILES for cumene;ethylbenzene;methane is C.CC(C)c1ccccc1.CCc1ccccc1.
What is the InChIKey of cumene;ethylbenzene;methane?
The InChIKey is MCVUYYNRLFJIAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C8H10.CH4/c1-8(2)9-6-4-3-5-7-9;1-2-8-6-4-3-5-7-8;/h3-8H,1-2H3;3-7H,2H2,1H3;1H4.
What are the key properties of cumene;ethylbenzene;methane?
cumene;ethylbenzene;methane has a molecular weight of 242.41 g/mol, XLogP of 5.70, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ethylbenzene;methane is sourced from PubChem (CID 159529846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).