About cumene;ethane;methane;propylbenzene
cumene;ethane;methane;propylbenzene (PubChem CID 142505404) has the molecular formula C21H34
and a molecular weight of 286.50 g/mol. Its IUPAC name is cumene;ethane;methane;propylbenzene.
Molecular Properties
| Compound Name | cumene;ethane;methane;propylbenzene |
| PubChem CID | 142505404 |
| Molecular Formula | C21H34 |
| Molecular Weight | 286.50 g/mol |
| Exact Mass | 286.27 |
| IUPAC Name | cumene;ethane;methane;propylbenzene |
| SMILES | C.CC.CC(C)c1ccccc1.CCCc1ccccc1 |
| InChI | InChI=1S/2C9H12.C2H6.CH4/c1-8(2)9-6-4-3-5-7-9;1-2-6-9-7-4-3-5-8-9;1-2;/h3-8H,1-2H3;3-5,7-8H,2,6H2,1H3;1-2H3;1H4 |
| InChIKey | HEXBXRDXCIOCMD-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.50 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cumene;ethane;methane;propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;ethane;methane;propylbenzene?
The IUPAC name of cumene;ethane;methane;propylbenzene (CID 142505404) is cumene;ethane;methane;propylbenzene.
What is the SMILES notation for cumene;ethane;methane;propylbenzene?
The canonical SMILES for cumene;ethane;methane;propylbenzene is C.CC.CC(C)c1ccccc1.CCCc1ccccc1.
What is the InChIKey of cumene;ethane;methane;propylbenzene?
The InChIKey is HEXBXRDXCIOCMD-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H12.C2H6.CH4/c1-8(2)9-6-4-3-5-7-9;1-2-6-9-7-4-3-5-8-9;1-2;/h3-8H,1-2H3;3-5,7-8H,2,6H2,1H3;1-2H3;1H4.
What are the key properties of cumene;ethane;methane;propylbenzene?
cumene;ethane;methane;propylbenzene has a molecular weight of 286.50 g/mol, XLogP of 7.11, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;ethane;methane;propylbenzene is sourced from PubChem (CID 142505404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).