C21H30 — CID 174543060
1,4-di(propan-2-yl)benzene;propylbenzene (PubChem CID 174543060) has the molecular formula C21H30 and a molecular weight of 282.47 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)benzene;propylbenzene.
| Compound Name | 1,4-di(propan-2-yl)benzene;propylbenzene |
|---|---|
| PubChem CID | 174543060 |
| Molecular Formula | C21H30 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1,4-di(propan-2-yl)benzene;propylbenzene |
| SMILES | CC(C)c1ccc(C(C)C)cc1.CCCc1ccccc1 |
| InChI | InChI=1S/C12H18.C9H12/c1-9(2)11-5-7-12(8-6-11)10(3)4;1-2-6-9-7-4-3-5-8-9/h5-10H,1-4H3;3-5,7-8H,2,6H2,1H3 |
| InChIKey | YEAKBHXVJDIBKS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |