C23H22O6 — CID 24800651
5-[hydroxy-(4-phenoxyphenyl)methyl]-2,3,4-trimethoxybenzaldehyde (PubChem CID 24800651) has the molecular formula C23H22O6 and a molecular weight of 394.42 g/mol. Its IUPAC name is 5-[hydroxy-(4-phenoxyphenyl)methyl]-2,3,4-trimethoxybenzaldehyde.
| Compound Name | 5-[hydroxy-(4-phenoxyphenyl)methyl]-2,3,4-trimethoxybenzaldehyde |
|---|---|
| PubChem CID | 24800651 |
| Molecular Formula | C23H22O6 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 5-[hydroxy-(4-phenoxyphenyl)methyl]-2,3,4-trimethoxybenzaldehyde |
| SMILES | COc1c(C=O)cc(C(O)c2ccc(Oc3ccccc3)cc2)c(OC)c1OC |
| InChI | InChI=1S/C23H22O6/c1-26-21-16(14-24)13-19(22(27-2)23(21)28-3)20(25)15-9-11-18(12-10-15)29-17-7-5-4-6-8-17/h4-14,20,25H,1-3H3 |
| InChIKey | YEHAQLOLDUJIBH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|