C15H11BrF4O — CID 160964271
1-bromo-2,5-difluoro-4-methylbenzene;2,5-difluoro-4-methylbenzaldehyde (PubChem CID 160964271) has the molecular formula C15H11BrF4O and a molecular weight of 363.15 g/mol. Its IUPAC name is 1-bromo-2,5-difluoro-4-methylbenzene;2,5-difluoro-4-methylbenzaldehyde.
| Compound Name | 1-bromo-2,5-difluoro-4-methylbenzene;2,5-difluoro-4-methylbenzaldehyde |
|---|---|
| PubChem CID | 160964271 |
| Molecular Formula | C15H11BrF4O |
| Molecular Weight | 363.15 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 1-bromo-2,5-difluoro-4-methylbenzene;2,5-difluoro-4-methylbenzaldehyde |
| SMILES | Cc1cc(F)c(Br)cc1F.Cc1cc(F)c(C=O)cc1F |
| InChI | InChI=1S/C8H6F2O.C7H5BrF2/c1-5-2-8(10)6(4-11)3-7(5)9;1-4-2-7(10)5(8)3-6(4)9/h2-4H,1H3;2-3H,1H3 |
| InChIKey | SXKFVZXKTHEXKN-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.15 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|