C10H11F2NO — CID 117288299
2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde (PubChem CID 117288299) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde.
| Compound Name | 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde |
|---|---|
| PubChem CID | 117288299 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde |
| SMILES | CC(CN)c1cc(F)c(F)cc1C=O |
| InChI | InChI=1S/C10H11F2NO/c1-6(4-13)8-3-10(12)9(11)2-7(8)5-14/h2-3,5-6H,4,13H2,1H3 |
| InChIKey | ZOHHDSPNQXJMTE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|