About 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde
2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde (PubChem CID 117288299) has the molecular formula C10H11F2NO
and a molecular weight of 199.20 g/mol. Its IUPAC name is 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde.
Molecular Properties
| Compound Name | 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde |
| PubChem CID | 117288299 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde |
| SMILES | CC(CN)c1cc(F)c(F)cc1C=O |
| InChI | InChI=1S/C10H11F2NO/c1-6(4-13)8-3-10(12)9(11)2-7(8)5-14/h2-3,5-6H,4,13H2,1H3 |
| InChIKey | ZOHHDSPNQXJMTE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde?
The IUPAC name of 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde (CID 117288299) is 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde.
What is the SMILES notation for 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde?
The canonical SMILES for 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde is CC(CN)c1cc(F)c(F)cc1C=O.
What is the InChIKey of 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde?
The InChIKey is ZOHHDSPNQXJMTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO/c1-6(4-13)8-3-10(12)9(11)2-7(8)5-14/h2-3,5-6H,4,13H2,1H3.
What are the key properties of 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde?
2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde has a molecular weight of 199.20 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-aminopropan-2-yl)-4,5-difluorobenzaldehyde is sourced from PubChem (CID 117288299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).