C9H11BrFNO — CID 83900254
2-(1-aminopropan-2-yl)-4-bromo-6-fluorophenol (PubChem CID 83900254) has the molecular formula C9H11BrFNO and a molecular weight of 248.09 g/mol. Its IUPAC name is 2-(1-aminopropan-2-yl)-4-bromo-6-fluorophenol.
| Compound Name | 2-(1-aminopropan-2-yl)-4-bromo-6-fluorophenol |
|---|---|
| PubChem CID | 83900254 |
| Molecular Formula | C9H11BrFNO |
| Molecular Weight | 248.09 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 2-(1-aminopropan-2-yl)-4-bromo-6-fluorophenol |
| SMILES | CC(CN)c1cc(Br)cc(F)c1O |
| InChI | InChI=1S/C9H11BrFNO/c1-5(4-12)7-2-6(10)3-8(11)9(7)13/h2-3,5,13H,4,12H2,1H3 |
| InChIKey | ORWYWDKMRRQEST-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.09 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |