C10H13F2NO2S — CID 117375876
2-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-amine (PubChem CID 117375876) has the molecular formula C10H13F2NO2S and a molecular weight of 249.28 g/mol. Its IUPAC name is 2-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-amine.
| Compound Name | 2-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 117375876 |
| Molecular Formula | C10H13F2NO2S |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(2,3-difluoro-5-methylsulfonylphenyl)propan-1-amine |
| SMILES | CC(CN)c1cc(S(C)(=O)=O)cc(F)c1F |
| InChI | InChI=1S/C10H13F2NO2S/c1-6(5-13)8-3-7(16(2,14)15)4-9(11)10(8)12/h3-4,6H,5,13H2,1-2H3 |
| InChIKey | GLWPABSRZMDQOM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |