C10H13F3N2O2S — CID 119982906
N-(1-aminopropan-2-yl)-3,4,5-trifluoro-N-methylbenzenesulfonamide (PubChem CID 119982906) has the molecular formula C10H13F3N2O2S and a molecular weight of 282.29 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-3,4,5-trifluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(1-aminopropan-2-yl)-3,4,5-trifluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 119982906 |
| Molecular Formula | C10H13F3N2O2S |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | N-(1-aminopropan-2-yl)-3,4,5-trifluoro-N-methylbenzenesulfonamide |
| SMILES | CC(CN)N(C)S(=O)(=O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H13F3N2O2S/c1-6(5-14)15(2)18(16,17)7-3-8(11)10(13)9(12)4-7/h3-4,6H,5,14H2,1-2H3 |
| InChIKey | MCWBFKGHZYKQBB-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|