C11H17BrN2O2S — CID 120710578
N-(1-aminopropan-2-yl)-3-bromo-N,5-dimethylbenzenesulfonamide (PubChem CID 120710578) has the molecular formula C11H17BrN2O2S and a molecular weight of 321.24 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-3-bromo-N,5-dimethylbenzenesulfonamide.
| Compound Name | N-(1-aminopropan-2-yl)-3-bromo-N,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 120710578 |
| Molecular Formula | C11H17BrN2O2S |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | N-(1-aminopropan-2-yl)-3-bromo-N,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(Br)cc(S(=O)(=O)N(C)C(C)CN)c1 |
| InChI | InChI=1S/C11H17BrN2O2S/c1-8-4-10(12)6-11(5-8)17(15,16)14(3)9(2)7-13/h4-6,9H,7,13H2,1-3H3 |
| InChIKey | OSKLPQDKEPBETP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |