C9H10F2O3S — CID 117344397
1-(2,3-difluoro-5-methylsulfonylphenyl)ethanol (PubChem CID 117344397) has the molecular formula C9H10F2O3S and a molecular weight of 236.24 g/mol. Its IUPAC name is 1-(2,3-difluoro-5-methylsulfonylphenyl)ethanol.
| Compound Name | 1-(2,3-difluoro-5-methylsulfonylphenyl)ethanol |
|---|---|
| PubChem CID | 117344397 |
| Molecular Formula | C9H10F2O3S |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | 1-(2,3-difluoro-5-methylsulfonylphenyl)ethanol |
| SMILES | CC(O)c1cc(S(C)(=O)=O)cc(F)c1F |
| InChI | InChI=1S/C9H10F2O3S/c1-5(12)7-3-6(15(2,13)14)4-8(10)9(7)11/h3-5,12H,1-2H3 |
| InChIKey | WSMFFUVFTYZFQG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |