C8H8F2N2O2S2 — CID 169359581
(2,6-difluoro-4-methylsulfonylphenyl)thiourea (PubChem CID 169359581) has the molecular formula C8H8F2N2O2S2 and a molecular weight of 266.29 g/mol. Its IUPAC name is (2,6-difluoro-4-methylsulfonylphenyl)thiourea.
| Compound Name | (2,6-difluoro-4-methylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 169359581 |
| Molecular Formula | C8H8F2N2O2S2 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | (2,6-difluoro-4-methylsulfonylphenyl)thiourea |
| SMILES | CS(=O)(=O)c1cc(F)c(NC(N)=S)c(F)c1 |
| InChI | InChI=1S/C8H8F2N2O2S2/c1-16(13,14)4-2-5(9)7(6(10)3-4)12-8(11)15/h2-3H,1H3,(H3,11,12,15) |
| InChIKey | HMUMCYTWOLBTDN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|