C7H4BrF3N2S — CID 169359816
(2-bromo-3,4,6-trifluorophenyl)thiourea (PubChem CID 169359816) has the molecular formula C7H4BrF3N2S and a molecular weight of 285.09 g/mol. Its IUPAC name is (2-bromo-3,4,6-trifluorophenyl)thiourea.
| Compound Name | (2-bromo-3,4,6-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 169359816 |
| Molecular Formula | C7H4BrF3N2S |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 283.92 |
| IUPAC Name | (2-bromo-3,4,6-trifluorophenyl)thiourea |
| SMILES | NC(=S)Nc1c(F)cc(F)c(F)c1Br |
| InChI | InChI=1S/C7H4BrF3N2S/c8-4-5(11)2(9)1-3(10)6(4)13-7(12)14/h1H,(H3,12,13,14) |
| InChIKey | FRJUPUYNRSAIDU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|