C7H7Br2N3O2S2 — CID 86202105
(2,6-dibromo-4-sulfamoylphenyl)thiourea (PubChem CID 86202105) has the molecular formula C7H7Br2N3O2S2 and a molecular weight of 389.09 g/mol. Its IUPAC name is (2,6-dibromo-4-sulfamoylphenyl)thiourea.
| Compound Name | (2,6-dibromo-4-sulfamoylphenyl)thiourea |
|---|---|
| PubChem CID | 86202105 |
| Molecular Formula | C7H7Br2N3O2S2 |
| Molecular Weight | 389.09 g/mol |
| Exact Mass | 386.83 |
| IUPAC Name | (2,6-dibromo-4-sulfamoylphenyl)thiourea |
| SMILES | NC(=S)Nc1c(Br)cc(S(N)(=O)=O)cc1Br |
| InChI | InChI=1S/C7H7Br2N3O2S2/c8-4-1-3(16(11,13)14)2-5(9)6(4)12-7(10)15/h1-2H,(H3,10,12,15)(H2,11,13,14) |
| InChIKey | ZZVKIGXRACAGJG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.09 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|