C7H5Br2N3O2S — CID 3776125
(2,6-dibromo-4-nitrophenyl)thiourea (PubChem CID 3776125) has the molecular formula C7H5Br2N3O2S and a molecular weight of 355.01 g/mol. Its IUPAC name is (2,6-dibromo-4-nitrophenyl)thiourea.
| Compound Name | (2,6-dibromo-4-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 3776125 |
| Molecular Formula | C7H5Br2N3O2S |
| Molecular Weight | 355.01 g/mol |
| Exact Mass | 352.85 |
| IUPAC Name | (2,6-dibromo-4-nitrophenyl)thiourea |
| SMILES | NC(=S)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C7H5Br2N3O2S/c8-4-1-3(12(13)14)2-5(9)6(4)11-7(10)15/h1-2H,(H3,10,11,15) |
| InChIKey | PLMPJKISULNZGB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.01 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|