C11H7Br2ClN4O3 — CID 19524825
2-(4-chloropyrazol-1-yl)-N-(2,6-dibromo-4-nitrophenyl)acetamide (PubChem CID 19524825) has the molecular formula C11H7Br2ClN4O3 and a molecular weight of 438.46 g/mol. Its IUPAC name is 2-(4-chloropyrazol-1-yl)-N-(2,6-dibromo-4-nitrophenyl)acetamide.
| Compound Name | 2-(4-chloropyrazol-1-yl)-N-(2,6-dibromo-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 19524825 |
| Molecular Formula | C11H7Br2ClN4O3 |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 435.86 |
| IUPAC Name | 2-(4-chloropyrazol-1-yl)-N-(2,6-dibromo-4-nitrophenyl)acetamide |
| SMILES | O=C(Cn1cc(Cl)cn1)Nc1c(Br)cc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C11H7Br2ClN4O3/c12-8-1-7(18(20)21)2-9(13)11(8)16-10(19)5-17-4-6(14)3-15-17/h1-4H,5H2,(H,16,19) |
| InChIKey | PAZTXKVLGUXGJS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|