C9H9BrN2O2S — CID 169357062
3-bromo-4-(carbamothioylamino)-5-methylbenzoic acid (PubChem CID 169357062) has the molecular formula C9H9BrN2O2S and a molecular weight of 289.15 g/mol. Its IUPAC name is 3-bromo-4-(carbamothioylamino)-5-methylbenzoic acid.
| Compound Name | 3-bromo-4-(carbamothioylamino)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 169357062 |
| Molecular Formula | C9H9BrN2O2S |
| Molecular Weight | 289.15 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 3-bromo-4-(carbamothioylamino)-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)cc(Br)c1NC(N)=S |
| InChI | InChI=1S/C9H9BrN2O2S/c1-4-2-5(8(13)14)3-6(10)7(4)12-9(11)15/h2-3H,1H3,(H,13,14)(H3,11,12,15) |
| InChIKey | NWESSQDLDFFTSJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|