C9H10Br2N2S — CID 169356329
(2,4-dibromo-6-ethylphenyl)thiourea (PubChem CID 169356329) has the molecular formula C9H10Br2N2S and a molecular weight of 338.07 g/mol. Its IUPAC name is (2,4-dibromo-6-ethylphenyl)thiourea.
| Compound Name | (2,4-dibromo-6-ethylphenyl)thiourea |
|---|---|
| PubChem CID | 169356329 |
| Molecular Formula | C9H10Br2N2S |
| Molecular Weight | 338.07 g/mol |
| Exact Mass | 335.89 |
| IUPAC Name | (2,4-dibromo-6-ethylphenyl)thiourea |
| SMILES | CCc1cc(Br)cc(Br)c1NC(N)=S |
| InChI | InChI=1S/C9H10Br2N2S/c1-2-5-3-6(10)4-7(11)8(5)13-9(12)14/h3-4H,2H2,1H3,(H3,12,13,14) |
| InChIKey | RLYHRUPGKCBVCT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.07 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|