C8H8Br2N2OS — CID 138682629
(2,4-dibromo-6-methoxyphenyl)thiourea (PubChem CID 138682629) has the molecular formula C8H8Br2N2OS and a molecular weight of 340.04 g/mol. Its IUPAC name is (2,4-dibromo-6-methoxyphenyl)thiourea.
| Compound Name | (2,4-dibromo-6-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 138682629 |
| Molecular Formula | C8H8Br2N2OS |
| Molecular Weight | 340.04 g/mol |
| Exact Mass | 337.87 |
| IUPAC Name | (2,4-dibromo-6-methoxyphenyl)thiourea |
| SMILES | COc1cc(Br)cc(Br)c1NC(N)=S |
| InChI | InChI=1S/C8H8Br2N2OS/c1-13-6-3-4(9)2-5(10)7(6)12-8(11)14/h2-3H,1H3,(H3,11,12,14) |
| InChIKey | OTSPEWXENOQWCI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.04 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|