C8H8F2N2S — CID 169359533
(3,5-difluoro-2-methylphenyl)thiourea (PubChem CID 169359533) has the molecular formula C8H8F2N2S and a molecular weight of 202.23 g/mol. Its IUPAC name is (3,5-difluoro-2-methylphenyl)thiourea.
| Compound Name | (3,5-difluoro-2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 169359533 |
| Molecular Formula | C8H8F2N2S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | (3,5-difluoro-2-methylphenyl)thiourea |
| SMILES | Cc1c(F)cc(F)cc1NC(N)=S |
| InChI | InChI=1S/C8H8F2N2S/c1-4-6(10)2-5(9)3-7(4)12-8(11)13/h2-3H,1H3,(H3,11,12,13) |
| InChIKey | PLGBNRWXOXKFFC-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|